B3reesheqtayleyplan B3reesheqtayleyplan
  • 03-01-2017
  • Geography
contestada

What is the largest marine biome, and how much of Earth’s surface does it cover?

Respuesta :

Аноним Аноним
  • 03-01-2017
Answer would be oceans and 75% covers Earth’s surface
Answer Link

Otras preguntas

|6+2x|=3x+4 HELPPPP A.-2,2 B.-1,1 C.-2 D.2
There are an infinite number of points that lie on a period at the end of a sentence. True or False
How do I expand the binomial (4x-2y)^4?
Find the exact value of sin(11pi/12)cos(pi/6)-cos(11pi/12)sin(pi/6)
A person who supports gay marriage listens to a televised debate between two politician on either sid of the issue
What explains the fact that no machine is 100 percent efficient?
if (x)=3x-1 and s(x)=2x+1, which is expression is equivalent to (r/s)(6)
What does constant speed look like on a distance versus time graph?
Which factor, along with opechancanough's uprising, led king james to revoke the virginia company charter and make virginia a royal colony in 1624?
why is a memoir an appropriate text structure for rosa parks to use to share her personal experience of a historical event